C22H28FN5O3 — CID 42783180
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-N-(3-methoxypropyl)pyrazine-2-carboxamide (PubChem CID 42783180) has the molecular formula C22H28FN5O3 and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-N-(3-methoxypropyl)pyrazine-2-carboxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-N-(3-methoxypropyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 42783180 |
| Molecular Formula | C22H28FN5O3 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-N-(3-methoxypropyl)pyrazine-2-carboxamide |
| SMILES | COCCCN(CCC(=O)N1CCN(c2ccccc2F)CC1)C(=O)c1cnccn1 |
| InChI | InChI=1S/C22H28FN5O3/c1-31-16-4-10-28(22(30)19-17-24-8-9-25-19)11-7-21(29)27-14-12-26(13-15-27)20-6-3-2-5-18(20)23/h2-3,5-6,8-9,17H,4,7,10-16H2,1H3 |
| InChIKey | NLXYASVLEPJNMN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|