C26H28FN5O3 — CID 42783239
N-[(4-fluorophenyl)methyl]-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxopropyl]pyrazine-2-carboxamide (PubChem CID 42783239) has the molecular formula C26H28FN5O3 and a molecular weight of 477.54 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxopropyl]pyrazine-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxopropyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 42783239 |
| Molecular Formula | C26H28FN5O3 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxopropyl]pyrazine-2-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)CCN(Cc3ccc(F)cc3)C(=O)c3cnccn3)CC2)cc1 |
| InChI | InChI=1S/C26H28FN5O3/c1-35-23-8-6-22(7-9-23)30-14-16-31(17-15-30)25(33)10-13-32(19-20-2-4-21(27)5-3-20)26(34)24-18-28-11-12-29-24/h2-9,11-12,18H,10,13-17,19H2,1H3 |
| InChIKey | VGJJUDQHHALWOT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|