C20H31N5O5 — CID 42782941
ethyl 4-[3-[3-methoxypropyl-(5-methylpyrazine-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate (PubChem CID 42782941) has the molecular formula C20H31N5O5 and a molecular weight of 421.50 g/mol. Its IUPAC name is ethyl 4-[3-[3-methoxypropyl-(5-methylpyrazine-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[3-methoxypropyl-(5-methylpyrazine-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42782941 |
| Molecular Formula | C20H31N5O5 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | ethyl 4-[3-[3-methoxypropyl-(5-methylpyrazine-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CCN(CCCOC)C(=O)c2cnc(C)cn2)CC1 |
| InChI | InChI=1S/C20H31N5O5/c1-4-30-20(28)25-11-9-23(10-12-25)18(26)6-8-24(7-5-13-29-3)19(27)17-15-21-16(2)14-22-17/h14-15H,4-13H2,1-3H3 |
| InChIKey | KZPAZXDGNUUMLU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 105.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|