C25H33N5O5 — CID 4087025
N-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-oxopropyl]-N-(3-ethoxypropyl)pyrazine-2-carboxamide (PubChem CID 4087025) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-oxopropyl]-N-(3-ethoxypropyl)pyrazine-2-carboxamide.
| Compound Name | N-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-oxopropyl]-N-(3-ethoxypropyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 4087025 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | N-[3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-oxopropyl]-N-(3-ethoxypropyl)pyrazine-2-carboxamide |
| SMILES | CCOCCCN(CCC(=O)N1CCN(Cc2ccc3c(c2)OCO3)CC1)C(=O)c1cnccn1 |
| InChI | InChI=1S/C25H33N5O5/c1-2-33-15-3-9-30(25(32)21-17-26-7-8-27-21)10-6-24(31)29-13-11-28(12-14-29)18-20-4-5-22-23(16-20)35-19-34-22/h4-5,7-8,16-17H,2-3,6,9-15,18-19H2,1H3 |
| InChIKey | PFLGBQNVAIYFMS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|