C17H22N4O4 — CID 3277023
N-(furan-2-ylmethyl)-N-[3-(3-methoxypropylamino)-3-oxopropyl]pyrazine-2-carboxamide (PubChem CID 3277023) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[3-(3-methoxypropylamino)-3-oxopropyl]pyrazine-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-N-[3-(3-methoxypropylamino)-3-oxopropyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 3277023 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[3-(3-methoxypropylamino)-3-oxopropyl]pyrazine-2-carboxamide |
| SMILES | COCCCNC(=O)CCN(Cc1ccco1)C(=O)c1cnccn1 |
| InChI | InChI=1S/C17H22N4O4/c1-24-10-3-6-20-16(22)5-9-21(13-14-4-2-11-25-14)17(23)15-12-18-7-8-19-15/h2,4,7-8,11-12H,3,5-6,9-10,13H2,1H3,(H,20,22) |
| InChIKey | GYOLNTVAMRLBIJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|