C9H8F3NO3 — CID 86749657
(5-amino-2,3,4-trifluorophenyl) ethyl carbonate (PubChem CID 86749657) has the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. Its IUPAC name is (5-amino-2,3,4-trifluorophenyl) ethyl carbonate.
| Compound Name | (5-amino-2,3,4-trifluorophenyl) ethyl carbonate |
|---|---|
| PubChem CID | 86749657 |
| Molecular Formula | C9H8F3NO3 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | (5-amino-2,3,4-trifluorophenyl) ethyl carbonate |
| SMILES | CCOC(=O)Oc1cc(N)c(F)c(F)c1F |
| InChI | InChI=1S/C9H8F3NO3/c1-2-15-9(14)16-5-3-4(13)6(10)8(12)7(5)11/h3H,2,13H2,1H3 |
| InChIKey | SVBRNIPRSXIJQF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|