C11H15N3O6 — CID 22363959
(5,6-diamino-2-ethoxycarbonyloxy-3-pyridinyl) ethyl carbonate (PubChem CID 22363959) has the molecular formula C11H15N3O6 and a molecular weight of 285.26 g/mol. Its IUPAC name is (5,6-diamino-2-ethoxycarbonyloxy-3-pyridinyl) ethyl carbonate.
| Compound Name | (5,6-diamino-2-ethoxycarbonyloxy-3-pyridinyl) ethyl carbonate |
|---|---|
| PubChem CID | 22363959 |
| Molecular Formula | C11H15N3O6 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (5,6-diamino-2-ethoxycarbonyloxy-3-pyridinyl) ethyl carbonate |
| SMILES | CCOC(=O)Oc1cc(N)c(N)nc1OC(=O)OCC |
| InChI | InChI=1S/C11H15N3O6/c1-3-17-10(15)19-7-5-6(12)8(13)14-9(7)20-11(16)18-4-2/h5H,3-4,12H2,1-2H3,(H2,13,14) |
| InChIKey | JLGQHFYQLHQXDB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |