C16H14O8 — CID 70348479
(3-ethoxycarbonyloxy-5,8-dioxonaphthalen-2-yl) ethyl carbonate (PubChem CID 70348479) has the molecular formula C16H14O8 and a molecular weight of 334.28 g/mol. Its IUPAC name is (3-ethoxycarbonyloxy-5,8-dioxonaphthalen-2-yl) ethyl carbonate.
| Compound Name | (3-ethoxycarbonyloxy-5,8-dioxonaphthalen-2-yl) ethyl carbonate |
|---|---|
| PubChem CID | 70348479 |
| Molecular Formula | C16H14O8 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (3-ethoxycarbonyloxy-5,8-dioxonaphthalen-2-yl) ethyl carbonate |
| SMILES | CCOC(=O)Oc1cc2c(cc1OC(=O)OCC)C(=O)C=CC2=O |
| InChI | InChI=1S/C16H14O8/c1-3-21-15(19)23-13-7-9-10(12(18)6-5-11(9)17)8-14(13)24-16(20)22-4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | SLMVMTKXUUSBDX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|