C26H24O12 — CID 140957707
ethyl [3,8,9-tris(ethoxycarbonyloxy)-2-tetracyclo[5.5.2.04,13.010,14]tetradeca-1(13),2,4,6,8,10(14),11-heptaenyl] carbonate (PubChem CID 140957707) has the molecular formula C26H24O12 and a molecular weight of 528.47 g/mol. Its IUPAC name is ethyl [3,8,9-tris(ethoxycarbonyloxy)-2-tetracyclo[5.5.2.04,13.010,14]tetradeca-1(13),2,4,6,8,10(14),11-heptaenyl] carbonate.
| Compound Name | ethyl [3,8,9-tris(ethoxycarbonyloxy)-2-tetracyclo[5.5.2.04,13.010,14]tetradeca-1(13),2,4,6,8,10(14),11-heptaenyl] carbonate |
|---|---|
| PubChem CID | 140957707 |
| Molecular Formula | C26H24O12 |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | ethyl [3,8,9-tris(ethoxycarbonyloxy)-2-tetracyclo[5.5.2.04,13.010,14]tetradeca-1(13),2,4,6,8,10(14),11-heptaenyl] carbonate |
| SMILES | CCOC(=O)OC1=C(OC(=O)OCC)c2ccc3c4c(ccc1c24)C(OC(=O)OCC)=C3OC(=O)OCC |
| InChI | InChI=1S/C26H24O12/c1-5-31-23(27)35-19-13-9-10-15-18-16(12-11-14(17(13)18)20(19)36-24(28)32-6-2)22(38-26(30)34-8-4)21(15)37-25(29)33-7-3/h9-12H,5-8H2,1-4H3 |
| InChIKey | DGLHJXWEVLVVCD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|