C14H18F3N3O2 — CID 113064473
N-[2-(propan-2-ylcarbamoylamino)ethyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 113064473) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is N-[2-(propan-2-ylcarbamoylamino)ethyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | N-[2-(propan-2-ylcarbamoylamino)ethyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 113064473 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[2-(propan-2-ylcarbamoylamino)ethyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CC(=O)N(CCNC(=O)NC(C)C)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H18F3N3O2/c1-8(2)19-14(22)18-6-7-20(9(3)21)11-5-4-10(15)12(16)13(11)17/h4-5,8H,6-7H2,1-3H3,(H2,18,19,22) |
| InChIKey | QQWQCIIAMOZDCR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|