C14H17F3N2O2 — CID 113181217
2-(N-acetyl-2,3,4-trifluoroanilino)-N-butylacetamide (PubChem CID 113181217) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 2-(N-acetyl-2,3,4-trifluoroanilino)-N-butylacetamide.
| Compound Name | 2-(N-acetyl-2,3,4-trifluoroanilino)-N-butylacetamide |
|---|---|
| PubChem CID | 113181217 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-(N-acetyl-2,3,4-trifluoroanilino)-N-butylacetamide |
| SMILES | CCCCNC(=O)CN(C(C)=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H17F3N2O2/c1-3-4-7-18-12(21)8-19(9(2)20)11-6-5-10(15)13(16)14(11)17/h5-6H,3-4,7-8H2,1-2H3,(H,18,21) |
| InChIKey | NIXSHXGSDXHFNX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|