C16H11Cl2F3N2O2 — CID 113181358
2-(N-acetyl-2,3,4-trifluoroanilino)-N-(2,5-dichlorophenyl)acetamide (PubChem CID 113181358) has the molecular formula C16H11Cl2F3N2O2 and a molecular weight of 391.18 g/mol. Its IUPAC name is 2-(N-acetyl-2,3,4-trifluoroanilino)-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-(N-acetyl-2,3,4-trifluoroanilino)-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 113181358 |
| Molecular Formula | C16H11Cl2F3N2O2 |
| Molecular Weight | 391.18 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 2-(N-acetyl-2,3,4-trifluoroanilino)-N-(2,5-dichlorophenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1cc(Cl)ccc1Cl)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H11Cl2F3N2O2/c1-8(24)23(13-5-4-11(19)15(20)16(13)21)7-14(25)22-12-6-9(17)2-3-10(12)18/h2-6H,7H2,1H3,(H,22,25) |
| InChIKey | XLKGLEABOXPXHU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.18 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|