C18H17F3N2O3 — CID 113181330
2-(N-acetyl-2,3,4-trifluoroanilino)-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 113181330) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is 2-(N-acetyl-2,3,4-trifluoroanilino)-N-(2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-(N-acetyl-2,3,4-trifluoroanilino)-N-(2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 113181330 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-(N-acetyl-2,3,4-trifluoroanilino)-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CN(C(C)=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H17F3N2O3/c1-10-4-7-15(26-3)13(8-10)22-16(25)9-23(11(2)24)14-6-5-12(19)17(20)18(14)21/h4-8H,9H2,1-3H3,(H,22,25) |
| InChIKey | CYRBNRVRTXWEKK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|