C17H14ClF3N2O3 — CID 113181324
2-(N-acetyl-2,3,4-trifluoroanilino)-N-(5-chloro-2-methoxyphenyl)acetamide (PubChem CID 113181324) has the molecular formula C17H14ClF3N2O3 and a molecular weight of 386.76 g/mol. Its IUPAC name is 2-(N-acetyl-2,3,4-trifluoroanilino)-N-(5-chloro-2-methoxyphenyl)acetamide.
| Compound Name | 2-(N-acetyl-2,3,4-trifluoroanilino)-N-(5-chloro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113181324 |
| Molecular Formula | C17H14ClF3N2O3 |
| Molecular Weight | 386.76 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2-(N-acetyl-2,3,4-trifluoroanilino)-N-(5-chloro-2-methoxyphenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN(C(C)=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H14ClF3N2O3/c1-9(24)23(13-5-4-11(19)16(20)17(13)21)8-15(25)22-12-7-10(18)3-6-14(12)26-2/h3-7H,8H2,1-2H3,(H,22,25) |
| InChIKey | UZXYUSRKFSCULW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.76 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|