C19H19ClN2O5 — CID 113176142
methyl 2-[acetyl-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]amino]benzoate (PubChem CID 113176142) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is methyl 2-[acetyl-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 2-[acetyl-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 113176142 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | methyl 2-[acetyl-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1N(CC(=O)Nc1cc(Cl)ccc1OC)C(C)=O |
| InChI | InChI=1S/C19H19ClN2O5/c1-12(23)22(16-7-5-4-6-14(16)19(25)27-3)11-18(24)21-15-10-13(20)8-9-17(15)26-2/h4-10H,11H2,1-3H3,(H,21,24) |
| InChIKey | GMVMMDRYQTWLIY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |