C27H60N2O7Si2 — CID 170548768
1,3-bis[4-tri(propan-2-yloxy)silylbutyl]urea (PubChem CID 170548768) has the molecular formula C27H60N2O7Si2 and a molecular weight of 580.96 g/mol. Its IUPAC name is 1,3-bis[4-tri(propan-2-yloxy)silylbutyl]urea.
| Compound Name | 1,3-bis[4-tri(propan-2-yloxy)silylbutyl]urea |
|---|---|
| PubChem CID | 170548768 |
| Molecular Formula | C27H60N2O7Si2 |
| Molecular Weight | 580.96 g/mol |
| Exact Mass | 580.39 |
| IUPAC Name | 1,3-bis[4-tri(propan-2-yloxy)silylbutyl]urea |
| SMILES | CC(C)O[Si](CCCCNC(=O)NCCCC[Si](OC(C)C)(OC(C)C)OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C27H60N2O7Si2/c1-21(2)31-37(32-22(3)4,33-23(5)6)19-15-13-17-28-27(30)29-18-14-16-20-38(34-24(7)8,35-25(9)10)36-26(11)12/h21-26H,13-20H2,1-12H3,(H2,28,29,30) |
| InChIKey | FDJZLHIXSQQYHH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.96 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|