C14H19F5O2Si — CID 90172442
dimethoxy-methyl-[5-(2,3,4,5,6-pentafluorophenyl)pentyl]silane (PubChem CID 90172442) has the molecular formula C14H19F5O2Si and a molecular weight of 342.38 g/mol. Its IUPAC name is dimethoxy-methyl-[5-(2,3,4,5,6-pentafluorophenyl)pentyl]silane.
| Compound Name | dimethoxy-methyl-[5-(2,3,4,5,6-pentafluorophenyl)pentyl]silane |
|---|---|
| PubChem CID | 90172442 |
| Molecular Formula | C14H19F5O2Si |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | dimethoxy-methyl-[5-(2,3,4,5,6-pentafluorophenyl)pentyl]silane |
| SMILES | CO[Si](C)(CCCCCc1c(F)c(F)c(F)c(F)c1F)OC |
| InChI | InChI=1S/C14H19F5O2Si/c1-20-22(3,21-2)8-6-4-5-7-9-10(15)12(17)14(19)13(18)11(9)16/h4-8H2,1-3H3 |
| InChIKey | MOUGIQBSNHGMAK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|