C19H29F5OSi — CID 90171678
hydroxy-[7-(2,3,4,5,6-pentafluorophenyl)heptyl]-di(propan-2-yl)silane (PubChem CID 90171678) has the molecular formula C19H29F5OSi and a molecular weight of 396.52 g/mol. Its IUPAC name is hydroxy-[7-(2,3,4,5,6-pentafluorophenyl)heptyl]-di(propan-2-yl)silane.
| Compound Name | hydroxy-[7-(2,3,4,5,6-pentafluorophenyl)heptyl]-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 90171678 |
| Molecular Formula | C19H29F5OSi |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | hydroxy-[7-(2,3,4,5,6-pentafluorophenyl)heptyl]-di(propan-2-yl)silane |
| SMILES | CC(C)[Si](O)(CCCCCCCc1c(F)c(F)c(F)c(F)c1F)C(C)C |
| InChI | InChI=1S/C19H29F5OSi/c1-12(2)26(25,13(3)4)11-9-7-5-6-8-10-14-15(20)17(22)19(24)18(23)16(14)21/h12-13,25H,5-11H2,1-4H3 |
| InChIKey | PJPJPAKXXPRZMK-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|