C16H26F2OSi — CID 90172191
4-(2,4-difluorophenyl)butyl-hydroxy-di(propan-2-yl)silane (PubChem CID 90172191) has the molecular formula C16H26F2OSi and a molecular weight of 300.46 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)butyl-hydroxy-di(propan-2-yl)silane.
| Compound Name | 4-(2,4-difluorophenyl)butyl-hydroxy-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 90172191 |
| Molecular Formula | C16H26F2OSi |
| Molecular Weight | 300.46 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 4-(2,4-difluorophenyl)butyl-hydroxy-di(propan-2-yl)silane |
| SMILES | CC(C)[Si](O)(CCCCc1ccc(F)cc1F)C(C)C |
| InChI | InChI=1S/C16H26F2OSi/c1-12(2)20(19,13(3)4)10-6-5-7-14-8-9-15(17)11-16(14)18/h8-9,11-13,19H,5-7,10H2,1-4H3 |
| InChIKey | YSOOKMLTZFSNIG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|