C15H24F2OSi — CID 90170935
4-(2,4-difluorophenyl)butyl-diethyl-methoxysilane (PubChem CID 90170935) has the molecular formula C15H24F2OSi and a molecular weight of 286.44 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)butyl-diethyl-methoxysilane.
| Compound Name | 4-(2,4-difluorophenyl)butyl-diethyl-methoxysilane |
|---|---|
| PubChem CID | 90170935 |
| Molecular Formula | C15H24F2OSi |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 4-(2,4-difluorophenyl)butyl-diethyl-methoxysilane |
| SMILES | CC[Si](CC)(CCCCc1ccc(F)cc1F)OC |
| InChI | InChI=1S/C15H24F2OSi/c1-4-19(5-2,18-3)11-7-6-8-13-9-10-14(16)12-15(13)17/h9-10,12H,4-8,11H2,1-3H3 |
| InChIKey | KHLSDJBVTWEASJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|