C10H12F2O3S — CID 58020486
3-(2,4-difluorophenyl)propyl methanesulfonate (PubChem CID 58020486) has the molecular formula C10H12F2O3S and a molecular weight of 250.27 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)propyl methanesulfonate.
| Compound Name | 3-(2,4-difluorophenyl)propyl methanesulfonate |
|---|---|
| PubChem CID | 58020486 |
| Molecular Formula | C10H12F2O3S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 3-(2,4-difluorophenyl)propyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCc1ccc(F)cc1F |
| InChI | InChI=1S/C10H12F2O3S/c1-16(13,14)15-6-2-3-8-4-5-9(11)7-10(8)12/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | MCJHYAQOTSDEKS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|