C12H15FO5S — CID 146523564
2-[4-(1,3-dioxolan-2-yl)-2-fluorophenyl]ethyl methanesulfonate (PubChem CID 146523564) has the molecular formula C12H15FO5S and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-[4-(1,3-dioxolan-2-yl)-2-fluorophenyl]ethyl methanesulfonate.
| Compound Name | 2-[4-(1,3-dioxolan-2-yl)-2-fluorophenyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 146523564 |
| Molecular Formula | C12H15FO5S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-[4-(1,3-dioxolan-2-yl)-2-fluorophenyl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCc1ccc(C2OCCO2)cc1F |
| InChI | InChI=1S/C12H15FO5S/c1-19(14,15)18-5-4-9-2-3-10(8-11(9)13)12-16-6-7-17-12/h2-3,8,12H,4-7H2,1H3 |
| InChIKey | LHVFGCWZQQSHCA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|