About 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane
2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane (PubChem CID 142891086) has the molecular formula C12H15FO3
and a molecular weight of 226.25 g/mol. Its IUPAC name is 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane |
| PubChem CID | 142891086 |
| Molecular Formula | C12H15FO3 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane |
| SMILES | CC(C)Oc1ccc(C2OCCO2)cc1F |
| InChI | InChI=1S/C12H15FO3/c1-8(2)16-11-4-3-9(7-10(11)13)12-14-5-6-15-12/h3-4,7-8,12H,5-6H2,1-2H3 |
| InChIKey | HTRJAGCTQWQCFX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane?
The IUPAC name of 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane (CID 142891086) is 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane.
What is the SMILES notation for 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane?
The canonical SMILES for 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane is CC(C)Oc1ccc(C2OCCO2)cc1F.
What is the InChIKey of 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane?
The InChIKey is HTRJAGCTQWQCFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO3/c1-8(2)16-11-4-3-9(7-10(11)13)12-14-5-6-15-12/h3-4,7-8,12H,5-6H2,1-2H3.
What are the key properties of 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane?
2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane has a molecular weight of 226.25 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane is sourced from PubChem (CID 142891086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).