C12H16FNO2 — CID 82473414
5-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-oxazolidine (PubChem CID 82473414) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 5-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-oxazolidine.
| Compound Name | 5-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 82473414 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 5-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-oxazolidine |
| SMILES | CC(C)Oc1ccc(C2CNCO2)cc1F |
| InChI | InChI=1S/C12H16FNO2/c1-8(2)16-11-4-3-9(5-10(11)13)12-6-14-7-15-12/h3-5,8,12,14H,6-7H2,1-2H3 |
| InChIKey | MVTLSNUBPBAHPJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |