About 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane
2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane (PubChem CID 142891085) has the molecular formula C18H29FO3S
and a molecular weight of 344.49 g/mol. Its IUPAC name is 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane.
Molecular Properties
| Compound Name | 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane |
| PubChem CID | 142891085 |
| Molecular Formula | C18H29FO3S |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane |
| SMILES | CC(C)Oc1ccc(C2OCCO2)cc1F.CC(C)SC(C)C |
| InChI | InChI=1S/C12H15FO3.C6H14S/c1-8(2)16-11-4-3-9(7-10(11)13)12-14-5-6-15-12;1-5(2)7-6(3)4/h3-4,7-8,12H,5-6H2,1-2H3;5-6H,1-4H3 |
| InChIKey | ZIBVQYRLKRBFPB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane?
The IUPAC name of 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane (CID 142891085) is 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane.
What is the SMILES notation for 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane?
The canonical SMILES for 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane is CC(C)Oc1ccc(C2OCCO2)cc1F.CC(C)SC(C)C.
What is the InChIKey of 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane?
The InChIKey is ZIBVQYRLKRBFPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO3.C6H14S/c1-8(2)16-11-4-3-9(7-10(11)13)12-14-5-6-15-12;1-5(2)7-6(3)4/h3-4,7-8,12H,5-6H2,1-2H3;5-6H,1-4H3.
What are the key properties of 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane?
2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane has a molecular weight of 344.49 g/mol, XLogP of 5.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluoro-4-propan-2-yloxyphenyl)-1,3-dioxolane;2-propan-2-ylsulfanylpropane is sourced from PubChem (CID 142891085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).