C17H26O4 — CID 83950062
2-[3,4-bis(2-methylpropoxy)phenyl]-1,3-dioxolane (PubChem CID 83950062) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-[3,4-bis(2-methylpropoxy)phenyl]-1,3-dioxolane.
| Compound Name | 2-[3,4-bis(2-methylpropoxy)phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 83950062 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-[3,4-bis(2-methylpropoxy)phenyl]-1,3-dioxolane |
| SMILES | CC(C)COc1ccc(C2OCCO2)cc1OCC(C)C |
| InChI | InChI=1S/C17H26O4/c1-12(2)10-20-15-6-5-14(17-18-7-8-19-17)9-16(15)21-11-13(3)4/h5-6,9,12-13,17H,7-8,10-11H2,1-4H3 |
| InChIKey | QLLGZFWGWKYBNQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |