C14H21NO3 — CID 82057123
2-butoxy-5-(1,3-dioxan-2-yl)aniline (PubChem CID 82057123) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-butoxy-5-(1,3-dioxan-2-yl)aniline.
| Compound Name | 2-butoxy-5-(1,3-dioxan-2-yl)aniline |
|---|---|
| PubChem CID | 82057123 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-butoxy-5-(1,3-dioxan-2-yl)aniline |
| SMILES | CCCCOc1ccc(C2OCCCO2)cc1N |
| InChI | InChI=1S/C14H21NO3/c1-2-3-7-16-13-6-5-11(10-12(13)15)14-17-8-4-9-18-14/h5-6,10,14H,2-4,7-9,15H2,1H3 |
| InChIKey | JUCAZXBBBXXVJX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|