C9H9FO3 — CID 18443673
4-(1,3-dioxolan-2-yl)-2-fluorophenol (PubChem CID 18443673) has the molecular formula C9H9FO3 and a molecular weight of 184.17 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)-2-fluorophenol.
| Compound Name | 4-(1,3-dioxolan-2-yl)-2-fluorophenol |
|---|---|
| PubChem CID | 18443673 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)-2-fluorophenol |
| SMILES | Oc1ccc(C2OCCO2)cc1F |
| InChI | InChI=1S/C9H9FO3/c10-7-5-6(1-2-8(7)11)9-12-3-4-13-9/h1-2,5,9,11H,3-4H2 |
| InChIKey | OKCUAEOZVYLCCZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |