C24H39F5O3Si — CID 90174966
9-(2,3,4,5,6-pentafluorophenyl)nonyl-tripropoxysilane (PubChem CID 90174966) has the molecular formula C24H39F5O3Si and a molecular weight of 498.65 g/mol. Its IUPAC name is 9-(2,3,4,5,6-pentafluorophenyl)nonyl-tripropoxysilane.
| Compound Name | 9-(2,3,4,5,6-pentafluorophenyl)nonyl-tripropoxysilane |
|---|---|
| PubChem CID | 90174966 |
| Molecular Formula | C24H39F5O3Si |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 9-(2,3,4,5,6-pentafluorophenyl)nonyl-tripropoxysilane |
| SMILES | CCCO[Si](CCCCCCCCCc1c(F)c(F)c(F)c(F)c1F)(OCCC)OCCC |
| InChI | InChI=1S/C24H39F5O3Si/c1-4-15-30-33(31-16-5-2,32-17-6-3)18-13-11-9-7-8-10-12-14-19-20(25)22(27)24(29)23(28)21(19)26/h4-18H2,1-3H3 |
| InChIKey | HZBBMEUANGMING-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|