C12H18F2O3Si — CID 90175060
5-(3,5-difluorophenyl)pentyl-dihydroxy-methoxysilane (PubChem CID 90175060) has the molecular formula C12H18F2O3Si and a molecular weight of 276.35 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)pentyl-dihydroxy-methoxysilane.
| Compound Name | 5-(3,5-difluorophenyl)pentyl-dihydroxy-methoxysilane |
|---|---|
| PubChem CID | 90175060 |
| Molecular Formula | C12H18F2O3Si |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-(3,5-difluorophenyl)pentyl-dihydroxy-methoxysilane |
| SMILES | CO[Si](O)(O)CCCCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H18F2O3Si/c1-17-18(15,16)6-4-2-3-5-10-7-11(13)9-12(14)8-10/h7-9,15-16H,2-6H2,1H3 |
| InChIKey | QUOWDOGNYMQJKD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|