C17H22F2O6Si — CID 90173628
[diacetyloxy-[5-(3,5-difluorophenyl)pentyl]silyl] acetate (PubChem CID 90173628) has the molecular formula C17H22F2O6Si and a molecular weight of 388.44 g/mol. Its IUPAC name is [diacetyloxy-[5-(3,5-difluorophenyl)pentyl]silyl] acetate.
| Compound Name | [diacetyloxy-[5-(3,5-difluorophenyl)pentyl]silyl] acetate |
|---|---|
| PubChem CID | 90173628 |
| Molecular Formula | C17H22F2O6Si |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [diacetyloxy-[5-(3,5-difluorophenyl)pentyl]silyl] acetate |
| SMILES | CC(=O)O[Si](CCCCCc1cc(F)cc(F)c1)(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H22F2O6Si/c1-12(20)23-26(24-13(2)21,25-14(3)22)8-6-4-5-7-15-9-16(18)11-17(19)10-15/h9-11H,4-8H2,1-3H3 |
| InChIKey | XQXOVBCRSJPBDX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|