C12H18F2O3Si — CID 90173670
6-(3,5-difluorophenyl)hexyl-trihydroxysilane (PubChem CID 90173670) has the molecular formula C12H18F2O3Si and a molecular weight of 276.35 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)hexyl-trihydroxysilane.
| Compound Name | 6-(3,5-difluorophenyl)hexyl-trihydroxysilane |
|---|---|
| PubChem CID | 90173670 |
| Molecular Formula | C12H18F2O3Si |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 6-(3,5-difluorophenyl)hexyl-trihydroxysilane |
| SMILES | O[Si](O)(O)CCCCCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H18F2O3Si/c13-11-7-10(8-12(14)9-11)5-3-1-2-4-6-18(15,16)17/h7-9,15-17H,1-6H2 |
| InChIKey | JBRNRUBWSJRUHZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|