C12H17F3O3Si — CID 90174592
trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane (PubChem CID 90174592) has the molecular formula C12H17F3O3Si and a molecular weight of 294.34 g/mol. Its IUPAC name is trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane.
| Compound Name | trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane |
|---|---|
| PubChem CID | 90174592 |
| Molecular Formula | C12H17F3O3Si |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane |
| SMILES | O[Si](O)(O)CCCCCCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H17F3O3Si/c13-9-7-11(14)10(12(15)8-9)5-3-1-2-4-6-19(16,17)18/h7-8,16-18H,1-6H2 |
| InChIKey | FFJSEGWVMLBSFD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|