About trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane
trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane (PubChem CID 90174592) has the molecular formula C12H17F3O3Si
and a molecular weight of 294.34 g/mol. Its IUPAC name is trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane.
Molecular Properties
| Compound Name | trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane |
| PubChem CID | 90174592 |
| Molecular Formula | C12H17F3O3Si |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane |
| SMILES | O[Si](O)(O)CCCCCCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H17F3O3Si/c13-9-7-11(14)10(12(15)8-9)5-3-1-2-4-6-19(16,17)18/h7-8,16-18H,1-6H2 |
| InChIKey | FFJSEGWVMLBSFD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane?
The IUPAC name of trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane (CID 90174592) is trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane.
What is the SMILES notation for trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane?
The canonical SMILES for trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane is O[Si](O)(O)CCCCCCc1c(F)cc(F)cc1F.
What is the InChIKey of trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane?
The InChIKey is FFJSEGWVMLBSFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3O3Si/c13-9-7-11(14)10(12(15)8-9)5-3-1-2-4-6-19(16,17)18/h7-8,16-18H,1-6H2.
What are the key properties of trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane?
trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane has a molecular weight of 294.34 g/mol, XLogP of 2.12, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trihydroxy-[6-(2,4,6-trifluorophenyl)hexyl]silane is sourced from PubChem (CID 90174592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).