C9H6F6 — CID 91063618
1-(3,3-difluoropropyl)-2,3,4,5-tetrafluorobenzene (PubChem CID 91063618) has the molecular formula C9H6F6 and a molecular weight of 228.13 g/mol. Its IUPAC name is 1-(3,3-difluoropropyl)-2,3,4,5-tetrafluorobenzene.
| Compound Name | 1-(3,3-difluoropropyl)-2,3,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 91063618 |
| Molecular Formula | C9H6F6 |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 1-(3,3-difluoropropyl)-2,3,4,5-tetrafluorobenzene |
| SMILES | Fc1cc(CCC(F)F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H6F6/c10-5-3-4(1-2-6(11)12)7(13)9(15)8(5)14/h3,6H,1-2H2 |
| InChIKey | DVGZUBLMUHCSNE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|