C9H11F3N2O — CID 164908467
5-(3,3-difluoropropyl)-3-fluoro-6-methoxypyridin-2-amine (PubChem CID 164908467) has the molecular formula C9H11F3N2O and a molecular weight of 220.19 g/mol. Its IUPAC name is 5-(3,3-difluoropropyl)-3-fluoro-6-methoxypyridin-2-amine.
| Compound Name | 5-(3,3-difluoropropyl)-3-fluoro-6-methoxypyridin-2-amine |
|---|---|
| PubChem CID | 164908467 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 5-(3,3-difluoropropyl)-3-fluoro-6-methoxypyridin-2-amine |
| SMILES | COc1nc(N)c(F)cc1CCC(F)F |
| InChI | InChI=1S/C9H11F3N2O/c1-15-9-5(2-3-7(11)12)4-6(10)8(13)14-9/h4,7H,2-3H2,1H3,(H2,13,14) |
| InChIKey | SDFUUQORPMRRBX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |