C13H20F2N2O — CID 114072964
6-(2-ethylhexoxy)-3,5-difluoropyridin-2-amine (PubChem CID 114072964) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is 6-(2-ethylhexoxy)-3,5-difluoropyridin-2-amine.
| Compound Name | 6-(2-ethylhexoxy)-3,5-difluoropyridin-2-amine |
|---|---|
| PubChem CID | 114072964 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 6-(2-ethylhexoxy)-3,5-difluoropyridin-2-amine |
| SMILES | CCCCC(CC)COc1nc(N)c(F)cc1F |
| InChI | InChI=1S/C13H20F2N2O/c1-3-5-6-9(4-2)8-18-13-11(15)7-10(14)12(16)17-13/h7,9H,3-6,8H2,1-2H3,(H2,16,17) |
| InChIKey | FBCWRVDIQVGFRG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |