C16H26ClNO — CID 55200147
3-(chloromethyl)-2-(2-ethylhexoxy)-4,6-dimethylpyridine (PubChem CID 55200147) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(2-ethylhexoxy)-4,6-dimethylpyridine.
| Compound Name | 3-(chloromethyl)-2-(2-ethylhexoxy)-4,6-dimethylpyridine |
|---|---|
| PubChem CID | 55200147 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-(chloromethyl)-2-(2-ethylhexoxy)-4,6-dimethylpyridine |
| SMILES | CCCCC(CC)COc1nc(C)cc(C)c1CCl |
| InChI | InChI=1S/C16H26ClNO/c1-5-7-8-14(6-2)11-19-16-15(10-17)12(3)9-13(4)18-16/h9,14H,5-8,10-11H2,1-4H3 |
| InChIKey | WDYXEJLPPOFPND-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|