About 2-amino-3,6-dichloro-4-fluorophenol
2-amino-3,6-dichloro-4-fluorophenol (PubChem CID 84666634) has the molecular formula C6H4Cl2FNO
and a molecular weight of 196.01 g/mol. Its IUPAC name is 2-amino-3,6-dichloro-4-fluorophenol.
Molecular Properties
| Compound Name | 2-amino-3,6-dichloro-4-fluorophenol |
| PubChem CID | 84666634 |
| Molecular Formula | C6H4Cl2FNO |
| Molecular Weight | 196.01 g/mol |
| Exact Mass | 194.97 |
| IUPAC Name | 2-amino-3,6-dichloro-4-fluorophenol |
| SMILES | Nc1c(O)c(Cl)cc(F)c1Cl |
| InChI | InChI=1S/C6H4Cl2FNO/c7-2-1-3(9)4(8)5(10)6(2)11/h1,11H,10H2 |
| InChIKey | RSSIXODLKGTHGE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.01 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3,6-dichloro-4-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,6-dichloro-4-fluorophenol?
The IUPAC name of 2-amino-3,6-dichloro-4-fluorophenol (CID 84666634) is 2-amino-3,6-dichloro-4-fluorophenol.
What is the SMILES notation for 2-amino-3,6-dichloro-4-fluorophenol?
The canonical SMILES for 2-amino-3,6-dichloro-4-fluorophenol is Nc1c(O)c(Cl)cc(F)c1Cl.
What is the InChIKey of 2-amino-3,6-dichloro-4-fluorophenol?
The InChIKey is RSSIXODLKGTHGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2FNO/c7-2-1-3(9)4(8)5(10)6(2)11/h1,11H,10H2.
What are the key properties of 2-amino-3,6-dichloro-4-fluorophenol?
2-amino-3,6-dichloro-4-fluorophenol has a molecular weight of 196.01 g/mol, XLogP of 2.42, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,6-dichloro-4-fluorophenol is sourced from PubChem (CID 84666634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).