C7H8ClIN2 — CID 90436399
2-chloro-4-iodo-5-methylbenzene-1,3-diamine (PubChem CID 90436399) has the molecular formula C7H8ClIN2 and a molecular weight of 282.51 g/mol. Its IUPAC name is 2-chloro-4-iodo-5-methylbenzene-1,3-diamine.
| Compound Name | 2-chloro-4-iodo-5-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 90436399 |
| Molecular Formula | C7H8ClIN2 |
| Molecular Weight | 282.51 g/mol |
| Exact Mass | 281.94 |
| IUPAC Name | 2-chloro-4-iodo-5-methylbenzene-1,3-diamine |
| SMILES | Cc1cc(N)c(Cl)c(N)c1I |
| InChI | InChI=1S/C7H8ClIN2/c1-3-2-4(10)5(8)7(11)6(3)9/h2H,10-11H2,1H3 |
| InChIKey | GMFMRSSBFIRVHQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|