C7H8ClNO2 — CID 84654764
3-amino-2-chloro-5-methylbenzene-1,4-diol (PubChem CID 84654764) has the molecular formula C7H8ClNO2 and a molecular weight of 173.60 g/mol. Its IUPAC name is 3-amino-2-chloro-5-methylbenzene-1,4-diol.
| Compound Name | 3-amino-2-chloro-5-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 84654764 |
| Molecular Formula | C7H8ClNO2 |
| Molecular Weight | 173.60 g/mol |
| Exact Mass | 173.02 |
| IUPAC Name | 3-amino-2-chloro-5-methylbenzene-1,4-diol |
| SMILES | Cc1cc(O)c(Cl)c(N)c1O |
| InChI | InChI=1S/C7H8ClNO2/c1-3-2-4(10)5(8)6(9)7(3)11/h2,10-11H,9H2,1H3 |
| InChIKey | ZTRGXHQIMQTWBU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.60 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|