C7H7ClO2 — CID 23510503
4-chloro-5-methylbenzene-1,2-diol (PubChem CID 23510503) has the molecular formula C7H7ClO2 and a molecular weight of 158.58 g/mol. Its IUPAC name is 4-chloro-5-methylbenzene-1,2-diol.
| Compound Name | 4-chloro-5-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 23510503 |
| Molecular Formula | C7H7ClO2 |
| Molecular Weight | 158.58 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | 4-chloro-5-methylbenzene-1,2-diol |
| SMILES | Cc1cc(O)c(O)cc1Cl |
| InChI | InChI=1S/C7H7ClO2/c1-4-2-6(9)7(10)3-5(4)8/h2-3,9-10H,1H3 |
| InChIKey | DJFHGZPAVXFRIJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.58 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|