C11H15ClO2 — CID 117305989
2-chloro-4-(3-hydroxypropyl)-3,5-dimethylphenol (PubChem CID 117305989) has the molecular formula C11H15ClO2 and a molecular weight of 214.69 g/mol. Its IUPAC name is 2-chloro-4-(3-hydroxypropyl)-3,5-dimethylphenol.
| Compound Name | 2-chloro-4-(3-hydroxypropyl)-3,5-dimethylphenol |
|---|---|
| PubChem CID | 117305989 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-chloro-4-(3-hydroxypropyl)-3,5-dimethylphenol |
| SMILES | Cc1cc(O)c(Cl)c(C)c1CCCO |
| InChI | InChI=1S/C11H15ClO2/c1-7-6-10(14)11(12)8(2)9(7)4-3-5-13/h6,13-14H,3-5H2,1-2H3 |
| InChIKey | HZWXPGJYAINQGF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |