C21H14AlF11O — CID 177045867
bis(2,3,4,6-tetrafluoro-4-methylcyclohexa-1,5-dien-1-yl)-(2,3,5-trifluoro-6-methoxyphenyl)alumane (PubChem CID 177045867) has the molecular formula C21H14AlF11O and a molecular weight of 518.30 g/mol. Its IUPAC name is bis(2,3,4,6-tetrafluoro-4-methylcyclohexa-1,5-dien-1-yl)-(2,3,5-trifluoro-6-methoxyphenyl)alumane.
| Compound Name | bis(2,3,4,6-tetrafluoro-4-methylcyclohexa-1,5-dien-1-yl)-(2,3,5-trifluoro-6-methoxyphenyl)alumane |
|---|---|
| PubChem CID | 177045867 |
| Molecular Formula | C21H14AlF11O |
| Molecular Weight | 518.30 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | bis(2,3,4,6-tetrafluoro-4-methylcyclohexa-1,5-dien-1-yl)-(2,3,5-trifluoro-6-methoxyphenyl)alumane |
| SMILES | COc1c(F)cc(F)c(F)c1[Al](C1=C(F)C(F)C(C)(F)C=C1F)C1=C(F)C(F)C(C)(F)C=C1F |
| InChI | InChI=1S/2C7H5F4.C7H4F3O.Al/c2*1-7(11)3-4(8)2-5(9)6(7)10;1-11-7-3-5(9)4(8)2-6(7)10;/h2*3,6H,1H3;2H,1H3; |
| InChIKey | ITJYVWZENOXBNX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.30 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|