C21H14BF11O — CID 177045916
bis(2,3,4,6-tetrafluoro-4-methylcyclohexa-1,5-dien-1-yl)-(2,3,5-trifluoro-6-methoxyphenyl)borane (PubChem CID 177045916) has the molecular formula C21H14BF11O and a molecular weight of 502.13 g/mol. Its IUPAC name is bis(2,3,4,6-tetrafluoro-4-methylcyclohexa-1,5-dien-1-yl)-(2,3,5-trifluoro-6-methoxyphenyl)borane.
| Compound Name | bis(2,3,4,6-tetrafluoro-4-methylcyclohexa-1,5-dien-1-yl)-(2,3,5-trifluoro-6-methoxyphenyl)borane |
|---|---|
| PubChem CID | 177045916 |
| Molecular Formula | C21H14BF11O |
| Molecular Weight | 502.13 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | bis(2,3,4,6-tetrafluoro-4-methylcyclohexa-1,5-dien-1-yl)-(2,3,5-trifluoro-6-methoxyphenyl)borane |
| SMILES | COc1c(F)cc(F)c(F)c1B(C1=C(F)C(F)C(C)(F)C=C1F)C1=C(F)C(F)C(C)(F)C=C1F |
| InChI | InChI=1S/C21H14BF11O/c1-20(32)5-9(25)11(15(28)18(20)30)22(12-10(26)6-21(2,33)19(31)16(12)29)13-14(27)7(23)4-8(24)17(13)34-3/h4-6,18-19H,1-3H3 |
| InChIKey | KKHIDUGQSUAHLN-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.13 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|