C19H8BF9O — CID 177045558
(2,4,6-trifluoro-3-methoxyphenyl)-bis(2,3,5-trifluorophenyl)borane (PubChem CID 177045558) has the molecular formula C19H8BF9O and a molecular weight of 434.07 g/mol. Its IUPAC name is (2,4,6-trifluoro-3-methoxyphenyl)-bis(2,3,5-trifluorophenyl)borane.
| Compound Name | (2,4,6-trifluoro-3-methoxyphenyl)-bis(2,3,5-trifluorophenyl)borane |
|---|---|
| PubChem CID | 177045558 |
| Molecular Formula | C19H8BF9O |
| Molecular Weight | 434.07 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | (2,4,6-trifluoro-3-methoxyphenyl)-bis(2,3,5-trifluorophenyl)borane |
| SMILES | COc1c(F)cc(F)c(B(c2cc(F)cc(F)c2F)c2cc(F)cc(F)c2F)c1F |
| InChI | InChI=1S/C19H8BF9O/c1-30-19-14(26)6-11(23)15(18(19)29)20(9-2-7(21)4-12(24)16(9)27)10-3-8(22)5-13(25)17(10)28/h2-6H,1H3 |
| InChIKey | JJZVUQTWKFMTOR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.07 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|