C21H15BF6O3 — CID 177045574
(2,4-difluoro-6-methoxyphenyl)-bis(3,5-difluoro-2-methoxyphenyl)borane (PubChem CID 177045574) has the molecular formula C21H15BF6O3 and a molecular weight of 440.15 g/mol. Its IUPAC name is (2,4-difluoro-6-methoxyphenyl)-bis(3,5-difluoro-2-methoxyphenyl)borane.
| Compound Name | (2,4-difluoro-6-methoxyphenyl)-bis(3,5-difluoro-2-methoxyphenyl)borane |
|---|---|
| PubChem CID | 177045574 |
| Molecular Formula | C21H15BF6O3 |
| Molecular Weight | 440.15 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (2,4-difluoro-6-methoxyphenyl)-bis(3,5-difluoro-2-methoxyphenyl)borane |
| SMILES | COc1cc(F)cc(F)c1B(c1cc(F)cc(F)c1OC)c1cc(F)cc(F)c1OC |
| InChI | InChI=1S/C21H15BF6O3/c1-29-18-9-12(25)6-15(26)19(18)22(13-4-10(23)7-16(27)20(13)30-2)14-5-11(24)8-17(28)21(14)31-3/h4-9H,1-3H3 |
| InChIKey | OEBLGMIZUJXUEO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.15 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|