C21H11BF10O — CID 177045553
(2,3,4,6-tetrafluoro-5-methoxyphenyl)-bis(2,3,6-trifluoro-4-methylphenyl)borane (PubChem CID 177045553) has the molecular formula C21H11BF10O and a molecular weight of 480.11 g/mol. Its IUPAC name is (2,3,4,6-tetrafluoro-5-methoxyphenyl)-bis(2,3,6-trifluoro-4-methylphenyl)borane.
| Compound Name | (2,3,4,6-tetrafluoro-5-methoxyphenyl)-bis(2,3,6-trifluoro-4-methylphenyl)borane |
|---|---|
| PubChem CID | 177045553 |
| Molecular Formula | C21H11BF10O |
| Molecular Weight | 480.11 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | (2,3,4,6-tetrafluoro-5-methoxyphenyl)-bis(2,3,6-trifluoro-4-methylphenyl)borane |
| SMILES | COc1c(F)c(F)c(F)c(B(c2c(F)cc(C)c(F)c2F)c2c(F)cc(C)c(F)c2F)c1F |
| InChI | InChI=1S/C21H11BF10O/c1-6-4-8(23)10(15(27)13(6)25)22(11-9(24)5-7(2)14(26)16(11)28)12-17(29)19(31)20(32)21(33-3)18(12)30/h4-5H,1-3H3 |
| InChIKey | WOGWYVBWWIZCSK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.11 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|