C19H6AlF11 — CID 177045557
bis(2,3,5,6-tetrafluorophenyl)-(2,4,6-trifluoro-3-methylphenyl)alumane (PubChem CID 177045557) has the molecular formula C19H6AlF11 and a molecular weight of 470.22 g/mol. Its IUPAC name is bis(2,3,5,6-tetrafluorophenyl)-(2,4,6-trifluoro-3-methylphenyl)alumane.
| Compound Name | bis(2,3,5,6-tetrafluorophenyl)-(2,4,6-trifluoro-3-methylphenyl)alumane |
|---|---|
| PubChem CID | 177045557 |
| Molecular Formula | C19H6AlF11 |
| Molecular Weight | 470.22 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | bis(2,3,5,6-tetrafluorophenyl)-(2,4,6-trifluoro-3-methylphenyl)alumane |
| SMILES | Cc1c(F)cc(F)c([Al](c2c(F)c(F)cc(F)c2F)c2c(F)c(F)cc(F)c2F)c1F |
| InChI | InChI=1S/C7H4F3.2C6HF4.Al/c1-4-6(9)2-5(8)3-7(4)10;2*7-3-1-4(8)6(10)2-5(3)9;/h2H,1H3;2*1H; |
| InChIKey | LEPIHDZLGKDPPP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|