C19H8AlF9 — CID 177045721
(2,4,6-trifluoro-3-methylphenyl)-bis(2,3,5-trifluorophenyl)alumane (PubChem CID 177045721) has the molecular formula C19H8AlF9 and a molecular weight of 434.24 g/mol. Its IUPAC name is (2,4,6-trifluoro-3-methylphenyl)-bis(2,3,5-trifluorophenyl)alumane.
| Compound Name | (2,4,6-trifluoro-3-methylphenyl)-bis(2,3,5-trifluorophenyl)alumane |
|---|---|
| PubChem CID | 177045721 |
| Molecular Formula | C19H8AlF9 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | (2,4,6-trifluoro-3-methylphenyl)-bis(2,3,5-trifluorophenyl)alumane |
| SMILES | Cc1c(F)cc(F)c([Al](c2cc(F)cc(F)c2F)c2cc(F)cc(F)c2F)c1F |
| InChI | InChI=1S/C7H4F3.2C6H2F3.Al/c1-4-6(9)2-5(8)3-7(4)10;2*7-4-1-2-5(8)6(9)3-4;/h2H,1H3;2*1,3H; |
| InChIKey | VPZNRFSGUBOKTB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|