C21H11AlF10O — CID 177045878
(2,4-difluoro-6-methoxyphenyl)-bis(2,3,5,6-tetrafluoro-4-methylphenyl)alumane (PubChem CID 177045878) has the molecular formula C21H11AlF10O and a molecular weight of 496.28 g/mol. Its IUPAC name is (2,4-difluoro-6-methoxyphenyl)-bis(2,3,5,6-tetrafluoro-4-methylphenyl)alumane.
| Compound Name | (2,4-difluoro-6-methoxyphenyl)-bis(2,3,5,6-tetrafluoro-4-methylphenyl)alumane |
|---|---|
| PubChem CID | 177045878 |
| Molecular Formula | C21H11AlF10O |
| Molecular Weight | 496.28 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | (2,4-difluoro-6-methoxyphenyl)-bis(2,3,5,6-tetrafluoro-4-methylphenyl)alumane |
| SMILES | COc1cc(F)cc(F)c1[Al](c1c(F)c(F)c(C)c(F)c1F)c1c(F)c(F)c(C)c(F)c1F |
| InChI | InChI=1S/2C7H3F4.C7H5F2O.Al/c2*1-3-6(10)4(8)2-5(9)7(3)11;1-10-7-3-5(8)2-6(9)4-7;/h2*1H3;2-3H,1H3; |
| InChIKey | GMDDIBRUFWXRNC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.28 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|